CAS 461692-98-8 is the registry number for N-(9H-Fluoren-9ylmethoxy)carbonyl]-d-homoserine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-hydroxybutanoic acid (CAS 461692-98-8) is a chemical compound with the molecular formula C19H19NO5 and a molecular weight of 341.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-hydroxybutanoic acid. InChIKey: YFCXLWRCVZSPCF-QGZVFWFLSA-N.
| Molecular formula | C19H19NO5 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-hydroxybutanoic acid |
| InChIKey | YFCXLWRCVZSPCF-QGZVFWFLSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCO)C(=O)O |
Computed by PubChem (NCBI)