CAS 172525-85-8 appears in our catalog under these names: Fmoc–L–homoserine, N-Fmoc-L-homoserine, Fmoc-Hse-OH 97%, N-Fmoc-L-homoserine, 98%, 98%, Fmoc-L-homoserine, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g, 100g, 500g, 100mg, 10g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-hydroxybutanoic acid (CAS 172525-85-8) is a chemical compound with the molecular formula C19H19NO5 and a molecular weight of 341.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-hydroxybutanoic acid. InChIKey: YFCXLWRCVZSPCF-KRWDZBQOSA-N.
| Molecular formula | C19H19NO5 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-hydroxybutanoic acid |
| InChIKey | YFCXLWRCVZSPCF-KRWDZBQOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCO)C(=O)O |
Computed by PubChem (NCBI)