CAS 1630984-19-8 is the registry number for (S)-1-(Naphthalen-2-yl)ethanamine hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 250mg.
(1S)-1-naphthalen-2-ylethanamine;hydrochloride (CAS 1630984-19-8) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: (1S)-1-naphthalen-2-ylethanamine;hydrochloride. InChIKey: SVJSCAQZYGXVIL-FVGYRXGTSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | (1S)-1-naphthalen-2-ylethanamine;hydrochloride |
| InChIKey | SVJSCAQZYGXVIL-FVGYRXGTSA-N |
| SMILES | C[C@@H](C1=CC2=CC=CC=C2C=C1)N.Cl |
Computed by PubChem (NCBI)