CAS 82572-03-0 appears in our catalog under these names: (R)-1-(Naphthalen-2-yl)ethanamine hydrochloride, 97%, 97%, (1R)-1-(NAPHTHALEN-2-YL)ETHAN-1-AMINE HCL, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g.
(1R)-1-naphthalen-2-ylethanamine;hydrochloride (CAS 82572-03-0) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: (1R)-1-naphthalen-2-ylethanamine;hydrochloride. InChIKey: SVJSCAQZYGXVIL-SBSPUUFOSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | (1R)-1-naphthalen-2-ylethanamine;hydrochloride |
| InChIKey | SVJSCAQZYGXVIL-SBSPUUFOSA-N |
| SMILES | C[C@H](C1=CC2=CC=CC=C2C=C1)N.Cl |
Computed by PubChem (NCBI)