CAS 163266-02-2 appears in our catalog under these names: 4,4,4-Trifluoro-1-(o-tolyl)butane-1,3-dione, 95%, Celecoxib Impurity 23, 4,4,4-Trifluoro-1-(2-methylphenyl)-1,3-butanedione, >95% (HPLC), 4,4,4–Trifluoro–1–(o–tolyl)butane–1,3–dione, 4,4,4-Trifluoro-1-(o-tolyl)butane-1,3-dione 97%. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg, on request, 10g, 25g.
4,4,4-trifluoro-1-(2-methylphenyl)butane-1,3-dione (CAS 163266-02-2) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: 4,4,4-trifluoro-1-(2-methylphenyl)butane-1,3-dione. InChIKey: NSWJGKUEKYWEEF-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-(2-methylphenyl)butane-1,3-dione |
| InChIKey | NSWJGKUEKYWEEF-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)