Products 1642794-76-0
CAS 1642794-76-0 is the registry number for Methyl 2-bromo-4-hydroxy-5-nitrobenzoate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-bromo-4-hydroxy-5-nitrobenzoate (CAS 1642794-76-0) is a chemical compound with the molecular formula C8H6BrNO5 and a molecular weight of 276.04 g/mol. IUPAC name: methyl 2-bromo-4-hydroxy-5-nitrobenzoate. InChIKey: POWDQMPFBJTUDD-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO5 |
|---|---|
| Molecular weight | 276.04 g/mol |
| IUPAC name | methyl 2-bromo-4-hydroxy-5-nitrobenzoate |
| InChIKey | POWDQMPFBJTUDD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Br)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)