CAS 164295-94-7 appears in our catalog under these names: 3-(2-Naphthyl)-1h-pyrazole-5-carboxylic acid, 95%, 5-NAPHTHALEN-2-YL-1H-PYRAZOLE-3-CARBOXYLIC ACID, ≥97%, ≥97%, 5-naphthalen-2-yl-1H-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 50mg, 250mg, 100mg.
3-naphthalen-2-yl-1H-pyrazole-5-carboxylic acid (CAS 164295-94-7) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 3-naphthalen-2-yl-1H-pyrazole-5-carboxylic acid. InChIKey: JQMUXXNJOLCBJJ-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 3-naphthalen-2-yl-1H-pyrazole-5-carboxylic acid |
| InChIKey | JQMUXXNJOLCBJJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=NNC(=C3)C(=O)O |
Computed by PubChem (NCBI)