Products 16459-38-4
CAS 16459-38-4 is the registry number for 5-Amino-1-(4-nitrophenyl)-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-amino-1-(4-nitrophenyl)pyrazole-4-carboxylic acid (CAS 16459-38-4) is a chemical compound with the molecular formula C10H8N4O4 and a molecular weight of 248.19 g/mol. IUPAC name: 5-amino-1-(4-nitrophenyl)pyrazole-4-carboxylic acid. InChIKey: VUYCAWFGQCSWAS-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O4 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 5-amino-1-(4-nitrophenyl)pyrazole-4-carboxylic acid |
| InChIKey | VUYCAWFGQCSWAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=C(C=N2)C(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)