CAS 937600-09-4 is the registry number for 5-Amino-2-(4-nitrophenyl)-1,3-oxazole-4-carboxamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-amino-2-(4-nitrophenyl)-1,3-oxazole-4-carboxamide (CAS 937600-09-4) is a chemical compound with the molecular formula C10H8N4O4 and a molecular weight of 248.19 g/mol. IUPAC name: 5-amino-2-(4-nitrophenyl)-1,3-oxazole-4-carboxamide. InChIKey: CKGXYZCTBSPYFG-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O4 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 5-amino-2-(4-nitrophenyl)-1,3-oxazole-4-carboxamide |
| InChIKey | CKGXYZCTBSPYFG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=C(O2)N)C(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)