CAS 623145-57-3 appears in our catalog under these names: 2-Np-ahd, 95%, NP-AHD, >95% (HPLC), 2-NP-AHD, 2–NP–AHD, NP-AHD. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, TargetMol, GLPBio. Available pack sizes: 100mg, 250mg, 50mg, 25mg, 10MG, 1x50mg, Get quote, 10 mg.
1-[(E)-(2-nitrophenyl)methylideneamino]imidazolidine-2,4-dione (CAS 623145-57-3) is a chemical compound with the molecular formula C10H8N4O4 and a molecular weight of 248.19 g/mol. IUPAC name: 1-[(E)-(2-nitrophenyl)methylideneamino]imidazolidine-2,4-dione. InChIKey: FULJCJZKZXOFQZ-VZUCSPMQSA-N.
| Molecular formula | C10H8N4O4 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 1-[(E)-(2-nitrophenyl)methylideneamino]imidazolidine-2,4-dione |
| InChIKey | FULJCJZKZXOFQZ-VZUCSPMQSA-N |
| SMILES | C1C(=O)NC(=O)N1/N=C/C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)