CAS 957493-95-7 appears in our catalog under these names: NP-AHD-13C3, 98% 98%atom%13C, NP-AHD-13C3. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 25mg, 10mg, 5mg, 50mg.
1-[(E)-(2-nitrophenyl)methylideneamino]-(2,4,5-13C3)1,3-diazolidine-2,4-dione (CAS 957493-95-7) is a chemical compound with the molecular formula C10H8N4O4 and a molecular weight of 251.17 g/mol. IUPAC name: 1-[(E)-(2-nitrophenyl)methylideneamino]-(2,4,5-13C3)1,3-diazolidine-2,4-dione. InChIKey: FULJCJZKZXOFQZ-OTQLJULOSA-N.
| Molecular formula | C10H8N4O4 |
|---|---|
| Molecular weight | 251.17 g/mol |
| IUPAC name | 1-[(E)-(2-nitrophenyl)methylideneamino]-(2,4,5-13C3)1,3-diazolidine-2,4-dione |
| InChIKey | FULJCJZKZXOFQZ-OTQLJULOSA-N |
| SMILES | [13CH2]1[13C](=O)N[13C](=O)N1/N=C/C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)