Products 374920-73-7
CAS 374920-73-7 is the registry number for 3-((3-Nitro-1H-1,2,4-triazol-1-yl)methyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(3-nitro-1,2,4-triazol-1-yl)methyl]benzoic acid (CAS 374920-73-7) is a chemical compound with the molecular formula C10H8N4O4 and a molecular weight of 248.19 g/mol. IUPAC name: 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]benzoic acid. InChIKey: PBPBRUBGUQMZBF-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O4 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 3-[(3-nitro-1,2,4-triazol-1-yl)methyl]benzoic acid |
| InChIKey | PBPBRUBGUQMZBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CN2C=NC(=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)