CAS 2374738-88-0 is the registry number for NP-AHD. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(E)-(2-nitrophenyl)methylideneamino]imidazolidine-2,4-dione (CAS 2374738-88-0) is a chemical compound with the molecular formula C10H8N4O4 and a molecular weight of 248.19 g/mol. IUPAC name: 1-[(E)-(2-nitrophenyl)methylideneamino]imidazolidine-2,4-dione. InChIKey: FULJCJZKZXOFQZ-VZUCSPMQSA-N.
| Molecular formula | C10H8N4O4 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 1-[(E)-(2-nitrophenyl)methylideneamino]imidazolidine-2,4-dione |
| InChIKey | FULJCJZKZXOFQZ-VZUCSPMQSA-N |
| SMILES | C1C(=O)NC(=O)N1/N=C/C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)