CAS 929975-73-5 appears in our catalog under these names: 5-Methyl-1-(3-nitrophenyl)-1H-1,2,3-triazole-4-carboxylic acid, 95%, 5-Methyl-1-(3-nitrophenyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-methyl-1-(3-nitrophenyl)triazole-4-carboxylic acid (CAS 929975-73-5) is a chemical compound with the molecular formula C10H8N4O4 and a molecular weight of 248.19 g/mol. IUPAC name: 5-methyl-1-(3-nitrophenyl)triazole-4-carboxylic acid. InChIKey: VKYUNNZXZFGGND-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O4 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 5-methyl-1-(3-nitrophenyl)triazole-4-carboxylic acid |
| InChIKey | VKYUNNZXZFGGND-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)