CAS 402720-88-1 appears in our catalog under these names: 4-[(3-Nitro-1h-1,2,4-triazol-1-yl)methyl]benzoic acid, 95%, 4-((3-Nitro-1H-1,2,4-triazol-1-yl)methyl)benzoic acid, 97%, 4-((3-Nitro-1H-1,2,4-triazol-1-yl)methyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
4-[(3-nitro-1,2,4-triazol-1-yl)methyl]benzoic acid (CAS 402720-88-1) is a chemical compound with the molecular formula C10H8N4O4 and a molecular weight of 248.19 g/mol. IUPAC name: 4-[(3-nitro-1,2,4-triazol-1-yl)methyl]benzoic acid. InChIKey: PIXUDTSYBZWQLQ-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O4 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 4-[(3-nitro-1,2,4-triazol-1-yl)methyl]benzoic acid |
| InChIKey | PIXUDTSYBZWQLQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC(=N2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)