CAS 16600-24-1 is the registry number for Norfloxacin Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid (CAS 16600-24-1) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: 7-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid. InChIKey: QZUCTUIUIAGUSQ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 7-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid |
| InChIKey | QZUCTUIUIAGUSQ-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=C1C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)