Products 16600-24-1

CAS 16600-24-1 is the registry number for Norfloxacin Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid (CAS 16600-24-1) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: 7-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid. InChIKey: QZUCTUIUIAGUSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10ClNO3
Molecular weight251.66 g/mol
IUPAC name7-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid
InChIKeyQZUCTUIUIAGUSQ-UHFFFAOYSA-N
SMILESCCN1C=C(C(=O)C2=C1C=C(C=C2)Cl)C(=O)O

Computed by PubChem (NCBI)