Products 1680175-67-0

CAS 1680175-67-0 is the registry number for Dapoxetine Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(1R)-3-chloro-1-phenylpropyl] methanesulfonate (CAS 1680175-67-0) is a chemical compound with the molecular formula C10H13ClO3S and a molecular weight of 248.73 g/mol. IUPAC name: [(1R)-3-chloro-1-phenylpropyl] methanesulfonate. InChIKey: KGTLAWKXWSHQBO-SNVBAGLBSA-N.

Identity
Molecular formulaC10H13ClO3S
Molecular weight248.73 g/mol
IUPAC name[(1R)-3-chloro-1-phenylpropyl] methanesulfonate
InChIKeyKGTLAWKXWSHQBO-SNVBAGLBSA-N
SMILESCS(=O)(=O)O[C@H](CCCl)C1=CC=CC=C1

Computed by PubChem (NCBI)