CAS 1680175-67-0 is the registry number for Dapoxetine Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R)-3-chloro-1-phenylpropyl] methanesulfonate (CAS 1680175-67-0) is a chemical compound with the molecular formula C10H13ClO3S and a molecular weight of 248.73 g/mol. IUPAC name: [(1R)-3-chloro-1-phenylpropyl] methanesulfonate. InChIKey: KGTLAWKXWSHQBO-SNVBAGLBSA-N.
| Molecular formula | C10H13ClO3S |
|---|---|
| Molecular weight | 248.73 g/mol |
| IUPAC name | [(1R)-3-chloro-1-phenylpropyl] methanesulfonate |
| InChIKey | KGTLAWKXWSHQBO-SNVBAGLBSA-N |
| SMILES | CS(=O)(=O)O[C@H](CCCl)C1=CC=CC=C1 |
Computed by PubChem (NCBI)