CAS 1138-56-3 appears in our catalog under these names: 4–Butoxybenzenesulfonyl Chloride, 4-n-Butoxybenzenesulfonyl chloride, 97% , 4-Butoxybenzenesulfonyl Chloride, 4-Butoxybenzene-1-sulfonyl chloride, 97% , 4-Butoxybenzenesulfonyl Chloride, >98.0%(GC). Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific, TCI. Available pack sizes: 1g, 250mg, 25g, 5g, 0,25g, 2,5g, 10g, 100g.
4-butoxybenzenesulfonyl chloride (CAS 1138-56-3) is a chemical compound with the molecular formula C10H13ClO3S and a molecular weight of 248.73 g/mol. IUPAC name: 4-butoxybenzenesulfonyl chloride. InChIKey: HGKWMUBXVMFXNC-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO3S |
|---|---|
| Molecular weight | 248.73 g/mol |
| IUPAC name | 4-butoxybenzenesulfonyl chloride |
| InChIKey | HGKWMUBXVMFXNC-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)