CAS 61440-60-6 is the registry number for 3-(4-Chlorophenyl)propyl Mesylate. Offered by: TRC. Available pack sizes: 500mg.
3-(4-chlorophenyl)propyl methanesulfonate (CAS 61440-60-6) is a chemical compound with the molecular formula C10H13ClO3S and a molecular weight of 248.73 g/mol. IUPAC name: 3-(4-chlorophenyl)propyl methanesulfonate. InChIKey: NPANKSZVBOAPFP-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO3S |
|---|---|
| Molecular weight | 248.73 g/mol |
| IUPAC name | 3-(4-chlorophenyl)propyl methanesulfonate |
| InChIKey | NPANKSZVBOAPFP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCCC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)