Products 80745-07-9

CAS 80745-07-9 appears in our catalog under these names: 4-Methoxy-2,3,6-trimethylbenzene-1-sulfonyl chloride, 95%, Mtr-Cl 95%, 4-Methoxy-2,3,6-trimethylbenzene-1-sulfonyl chloride, 95%+,RG. Offered by: AmBeed, Fluorochem. Available pack sizes: 250mg, 5g, 25g, 10g, 1g.

Structural formula: {0} (CAS {1})

4-methoxy-2,3,6-trimethylbenzenesulfonyl chloride (CAS 80745-07-9) is a chemical compound with the molecular formula C10H13ClO3S and a molecular weight of 248.73 g/mol. IUPAC name: 4-methoxy-2,3,6-trimethylbenzenesulfonyl chloride. InChIKey: DWLYVEYCCPEHLX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClO3S
Molecular weight248.73 g/mol
IUPAC name4-methoxy-2,3,6-trimethylbenzenesulfonyl chloride
InChIKeyDWLYVEYCCPEHLX-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1S(=O)(=O)Cl)C)C)OC

Computed by PubChem (NCBI)