CAS 80745-07-9 appears in our catalog under these names: 4-Methoxy-2,3,6-trimethylbenzene-1-sulfonyl chloride, 95%, Mtr-Cl 95%, 4-Methoxy-2,3,6-trimethylbenzene-1-sulfonyl chloride, 95%+,RG. Offered by: AmBeed, Fluorochem. Available pack sizes: 250mg, 5g, 25g, 10g, 1g.
4-methoxy-2,3,6-trimethylbenzenesulfonyl chloride (CAS 80745-07-9) is a chemical compound with the molecular formula C10H13ClO3S and a molecular weight of 248.73 g/mol. IUPAC name: 4-methoxy-2,3,6-trimethylbenzenesulfonyl chloride. InChIKey: DWLYVEYCCPEHLX-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO3S |
|---|---|
| Molecular weight | 248.73 g/mol |
| IUPAC name | 4-methoxy-2,3,6-trimethylbenzenesulfonyl chloride |
| InChIKey | DWLYVEYCCPEHLX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1S(=O)(=O)Cl)C)C)OC |
Computed by PubChem (NCBI)