Products 1368500-44-0
CAS 1368500-44-0 is the registry number for 4-Isopropyl-2-methoxybenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methoxy-4-propan-2-ylbenzenesulfonyl chloride (CAS 1368500-44-0) is a chemical compound with the molecular formula C10H13ClO3S and a molecular weight of 248.73 g/mol. IUPAC name: 2-methoxy-4-propan-2-ylbenzenesulfonyl chloride. InChIKey: JMZRQIYDQDTAGD-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO3S |
|---|---|
| Molecular weight | 248.73 g/mol |
| IUPAC name | 2-methoxy-4-propan-2-ylbenzenesulfonyl chloride |
| InChIKey | JMZRQIYDQDTAGD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)