Products 1784362-72-6

CAS 1784362-72-6 appears in our catalog under these names: 2-Methoxy-2-phenylpropane-1-sulfonyl chloride, 95%, 2-Methoxy-2-phenylpropane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2-methoxy-2-phenylpropane-1-sulfonyl chloride (CAS 1784362-72-6) is a chemical compound with the molecular formula C10H13ClO3S and a molecular weight of 248.73 g/mol. IUPAC name: 2-methoxy-2-phenylpropane-1-sulfonyl chloride. InChIKey: HYMLCBNLAZWMAU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClO3S
Molecular weight248.73 g/mol
IUPAC name2-methoxy-2-phenylpropane-1-sulfonyl chloride
InChIKeyHYMLCBNLAZWMAU-UHFFFAOYSA-N
SMILESCC(CS(=O)(=O)Cl)(C1=CC=CC=C1)OC

Computed by PubChem (NCBI)