CAS 1094296-27-1 is the registry number for 4-Ethoxy-2,3-dimethylbenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-ethoxy-2,3-dimethylbenzenesulfonyl chloride (CAS 1094296-27-1) is a chemical compound with the molecular formula C10H13ClO3S and a molecular weight of 248.73 g/mol. IUPAC name: 4-ethoxy-2,3-dimethylbenzenesulfonyl chloride. InChIKey: LWHPNBNEGVCNHG-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO3S |
|---|---|
| Molecular weight | 248.73 g/mol |
| IUPAC name | 4-ethoxy-2,3-dimethylbenzenesulfonyl chloride |
| InChIKey | LWHPNBNEGVCNHG-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)S(=O)(=O)Cl)C)C |
Computed by PubChem (NCBI)