CAS 632-02-0 appears in our catalog under these names: 3-Chloropropyl p-toluenesulfonate, 1-Chloro-3-(tolene-p-sulphonyloxy) propane, 3-Chloropropyl 4-Methylbenzenesulfonate, 95+%, 95+%, 3-CHLOROPROPYL 4-METHYLBENZENESULFONATE, 95+%. Offered by: Chemat Brand, Biosynth, Chemat, Fluorochem. Available pack sizes: on request, 2,5g, 100mg, 250mg, 1g, 5g.
3-chloropropyl 4-methylbenzenesulfonate (CAS 632-02-0) is a chemical compound with the molecular formula C10H13ClO3S and a molecular weight of 248.73 g/mol. IUPAC name: 3-chloropropyl 4-methylbenzenesulfonate. InChIKey: NQCQVNHLNXCSPY-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO3S |
|---|---|
| Molecular weight | 248.73 g/mol |
| IUPAC name | 3-chloropropyl 4-methylbenzenesulfonate |
| InChIKey | NQCQVNHLNXCSPY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCCl |
Computed by PubChem (NCBI)