CAS 627082-12-6 is the registry number for 3-Isopropyl-4-methoxybenzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-methoxy-3-propan-2-ylbenzenesulfonyl chloride (CAS 627082-12-6) is a chemical compound with the molecular formula C10H13ClO3S and a molecular weight of 248.73 g/mol. IUPAC name: 4-methoxy-3-propan-2-ylbenzenesulfonyl chloride. InChIKey: VKOMAPGWMCUJAX-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO3S |
|---|---|
| Molecular weight | 248.73 g/mol |
| IUPAC name | 4-methoxy-3-propan-2-ylbenzenesulfonyl chloride |
| InChIKey | VKOMAPGWMCUJAX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC(=C1)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)