CAS 16838-76-9 is the registry number for trans-3-(Carboxymethyl)-2,2-dimethylcyclopropane-1-carboxylic Acid. Offered by: TRC. Available pack sizes: 100mg.
Cis-(1S,3S)-3-(carboxymethyl)-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 16838-76-9) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: cis-(1S,3S)-3-(carboxymethyl)-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: LTOCWJJBRJUVNV-UJURSFKZSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | cis-(1S,3S)-3-(carboxymethyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | LTOCWJJBRJUVNV-UJURSFKZSA-N |
| SMILES | CC1([C@H]([C@@H]1C(=O)O)CC(=O)O)C |
Computed by PubChem (NCBI)