CAS 1846-46-4 is the registry number for Cis-3-(Carboxymethyl)-2,2-dimethylcyclopropane-1-carboxylic Acid. Offered by: TRC. Available pack sizes: 100mg.
Trans-(1R,3S)-3-(carboxymethyl)-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 1846-46-4) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1R,3S)-3-(carboxymethyl)-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: LTOCWJJBRJUVNV-NJGYIYPDSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | trans-(1R,3S)-3-(carboxymethyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | LTOCWJJBRJUVNV-NJGYIYPDSA-N |
| SMILES | CC1([C@H]([C@H]1C(=O)O)CC(=O)O)C |
Computed by PubChem (NCBI)