CAS 1686143-09-8 is the registry number for 5-benzoyl-1,3-benzoxazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2-amino-1,3-benzoxazol-5-yl)-phenylmethanone (CAS 1686143-09-8) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: (2-amino-1,3-benzoxazol-5-yl)-phenylmethanone. InChIKey: PAXCAXAQROMVLC-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | (2-amino-1,3-benzoxazol-5-yl)-phenylmethanone |
| InChIKey | PAXCAXAQROMVLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC3=C(C=C2)OC(=N3)N |
Computed by PubChem (NCBI)