CAS 168902-74-7 appears in our catalog under these names: (S)-4,5-Dimethoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, 98%, 98%, (S)-4,5-Dimethoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 25mg, 50mg.
(1S)-4,5-dimethoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 168902-74-7) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: (1S)-4,5-dimethoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: LYNRJPIDGDEFED-FVGYRXGTSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | (1S)-4,5-dimethoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | LYNRJPIDGDEFED-FVGYRXGTSA-N |
| SMILES | COC1=C(C2=C(C=C1)[C@H](CC2)N)OC.Cl |
Computed by PubChem (NCBI)