Products 168902-75-8
CAS 168902-75-8 appears in our catalog under these names: 4,5-Dimethoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, 4,5-Dimethoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, 98%, 98%, 4,5-Dimethoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
4,5-dimethoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 168902-75-8) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: 4,5-dimethoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: LYNRJPIDGDEFED-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | 4,5-dimethoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | LYNRJPIDGDEFED-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C(CC2)N)OC.Cl |
Computed by PubChem (NCBI)