CAS 1692004-40-2 appears in our catalog under these names: 1-(5-Bromo-2-chlorophenyl)-2,2,2-trifluoroethan-1-ol, 98%, 1-(5-Bromo-2-chlorophenyl)-2,2,2-trifluoroethan-1-ol, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
1-(5-bromo-2-chlorophenyl)-2,2,2-trifluoroethanol (CAS 1692004-40-2) is a chemical compound with the molecular formula C8H5BrClF3O and a molecular weight of 289.47 g/mol. IUPAC name: 1-(5-bromo-2-chlorophenyl)-2,2,2-trifluoroethanol. InChIKey: QPDLSISMBOXVQA-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3O |
|---|---|
| Molecular weight | 289.47 g/mol |
| IUPAC name | 1-(5-bromo-2-chlorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | QPDLSISMBOXVQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(C(F)(F)F)O)Cl |
Computed by PubChem (NCBI)