Products 1704064-20-9
CAS 1704064-20-9 appears in our catalog under these names: (2-Ethoxy-3-methylphenyl)boronic acid, 95%, (2-Ethoxy-3-methylphenyl)boronic acid, 98%, (2–Ethoxy–3–methylphenyl)boronic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 500mg.
(2-ethoxy-3-methylphenyl)boronic acid (CAS 1704064-20-9) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (2-ethoxy-3-methylphenyl)boronic acid. InChIKey: ADTILJSFJHWHES-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (2-ethoxy-3-methylphenyl)boronic acid |
| InChIKey | ADTILJSFJHWHES-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C)OCC)(O)O |
Computed by PubChem (NCBI)