Products 170981-41-6
CAS 170981-41-6 appears in our catalog under these names: 2,3–Difluoro–4–methoxybenzeneboronic acid, 2,3-Difluoro-4-methoxyphenylboronic Acid (contains varying amounts of Anhydride), (2,3-Difluoro-4-methoxyphenyl)boronic acid, 95%, (2,3-Difluoro-4-methoxyphenyl)boronic acid, 97%. Offered by: GLPBio, TCI, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 250mg.
(2,3-difluoro-4-methoxyphenyl)boronic acid (CAS 170981-41-6) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (2,3-difluoro-4-methoxyphenyl)boronic acid. InChIKey: HIWYFMBSFSTYGU-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (2,3-difluoro-4-methoxyphenyl)boronic acid |
| InChIKey | HIWYFMBSFSTYGU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OC)F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2,3-difluoro-4-methoxyphenyl)boronic acid, Boronic acid, (2,3-difluoro-4-methoxyphenyl)-, (2,3-Difluoro-4-methoxy-phenyl)boronic acid, (2,3-Difluoro-4-methoxyphenyl);boronic acid, Boronicacid, B-(2,3-difluoro-4-methoxyphenyl)-, 2,3-difluoro-4-methoxyphenylboronic aicd, 2,3-Difluoro-4-meth, (2,3-Difluoro-4-methoxyphenyl)boronicacid, 2,3-Difluoro-4-methoxyphenylboronic Acid (contains varying amounts of Anhydride)