Products 171050-06-9
CAS 171050-06-9 appears in our catalog under these names: 3–Cyano–4–fluorobenzoic acid, 3-Cyano-4-fluorobenzoic acid, 3-Cyano-4-fluorobenzoic acid 97%, 3-Cyano-4-fluorobenzoic acid, 97%, 97%, 3-Cyano-4-fluorobenzoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 2g, 5g, 10g, 250mg, 25g, 100mg.
3-cyano-4-fluorobenzoic acid (CAS 171050-06-9) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 3-cyano-4-fluorobenzoic acid. InChIKey: JMHGATOBRPWPBZ-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 3-cyano-4-fluorobenzoic acid |
| InChIKey | JMHGATOBRPWPBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C#N)F |
Computed by PubChem (NCBI)