CAS 1715-81-7 appears in our catalog under these names: 1-Hydroxy-9,10-dihydroanthracen-9-one, 1-Hydroxyanthracen-9(10H)-one. Offered by: TRC, Mikromol. Available pack sizes: 250mg, 25mg.
1-hydroxy-10H-anthracen-9-one (CAS 1715-81-7) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 1-hydroxy-10H-anthracen-9-one. InChIKey: AXHRXVXCOMMNLG-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 1-hydroxy-10H-anthracen-9-one |
| InChIKey | AXHRXVXCOMMNLG-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)O)C(=O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)