Products 171905-91-2
CAS 171905-91-2 is the registry number for 2-(3-Methoxycarbonylphenyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(3-methoxycarbonylphenyl)benzoic acid (CAS 171905-91-2) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 2-(3-methoxycarbonylphenyl)benzoic acid. InChIKey: WAFGUHOIRJDARG-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 2-(3-methoxycarbonylphenyl)benzoic acid |
| InChIKey | WAFGUHOIRJDARG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)