CAS 17311-31-8 appears in our catalog under these names: 2,3-Bis(hydroxymethyl)-1-oxoquinoxalin-1-ium-4(1h)-olate, 95%, Dioxidine, Dioxidine, >95% (HPLC), (1,4-Dioxidoquinoxaline-2,3-diyl)dimethanol, Dioxidine, 98.03%. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, on request, 100mg, 50mg, 5mg, 0,05kg.
[3-(hydroxymethyl)-1-oxido-4-oxoquinoxalin-4-ium-2-yl]methanol (CAS 17311-31-8) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: [3-(hydroxymethyl)-1-oxido-4-oxoquinoxalin-4-ium-2-yl]methanol. InChIKey: DOIGHQCAQBRSKI-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | [3-(hydroxymethyl)-1-oxido-4-oxoquinoxalin-4-ium-2-yl]methanol |
| InChIKey | DOIGHQCAQBRSKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C(=C([N+]2=O)CO)CO)[O-] |
Computed by PubChem (NCBI)