CAS 175136-04-6 is the registry number for Ethyl 2-chloro-3,4-dimethoxybenzoate, 97% . Offered by: Thermo Scientific. Available pack sizes: 10g.
Ethyl 2-chloro-3,4-dimethoxybenzoate (CAS 175136-04-6) is a chemical compound with the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. IUPAC name: ethyl 2-chloro-3,4-dimethoxybenzoate. InChIKey: AXNMDQHZRJDVRG-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO4 |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | ethyl 2-chloro-3,4-dimethoxybenzoate |
| InChIKey | AXNMDQHZRJDVRG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1)OC)OC)Cl |
Computed by PubChem (NCBI)