Products 767359-25-1
CAS 767359-25-1 appears in our catalog under these names: 2-(2-Bromophenyl)cyclopropane-1-carboxylic acid, 2–(2–Bromophenyl)cyclopropanecarboxylic acid, 2-(2-Bromophenyl)cyclopropane-1-carboxylic acid, 95%+, 95%+, 2-(2-Bromophenyl)cyclopropanecarboxylic acid, 95%. Offered by: Biosynth, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg.
2-(2-bromophenyl)cyclopropane-1-carboxylic acid (CAS 767359-25-1) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 2-(2-bromophenyl)cyclopropane-1-carboxylic acid. InChIKey: SJXGNJABBYVEHY-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 2-(2-bromophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | SJXGNJABBYVEHY-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)O)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)