CAS 17557-42-5 is the registry number for 2-(1-Benzofuran-2-carbonyl)pyridine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-benzofuran-2-yl(pyridin-2-yl)methanone (CAS 17557-42-5) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 1-benzofuran-2-yl(pyridin-2-yl)methanone. InChIKey: AIWBXPOZNQQOQG-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 1-benzofuran-2-yl(pyridin-2-yl)methanone |
| InChIKey | AIWBXPOZNQQOQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C(=O)C3=CC=CC=N3 |
Computed by PubChem (NCBI)