CAS 17720-64-8 appears in our catalog under these names: 1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl acetate, 2-(Acetyloxy)-1H-isoindole-1,3(2H)-dione, 97%, 97%, 1,3-Dioxoisoindolin-2-yl acetate, 98%, 1,3-Dioxoisoindolin-2-yl acetate, 97%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 25g, 100g.
(1,3-dioxoisoindol-2-yl) acetate (CAS 17720-64-8) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) acetate. InChIKey: IJRNYIWWGDQEIY-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) acetate |
| InChIKey | IJRNYIWWGDQEIY-UHFFFAOYSA-N |
| SMILES | CC(=O)ON1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)