Products 1781933-01-4
CAS 1781933-01-4 is the registry number for 1-(3-(4-Chlorophenyl)-1,2,4-oxadiazol-5-yl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride (CAS 1781933-01-4) is a chemical compound with the molecular formula C10H11Cl2N3O and a molecular weight of 260.12 g/mol. IUPAC name: 1-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride. InChIKey: OXTHFDZPHYKSNY-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3O |
|---|---|
| Molecular weight | 260.12 g/mol |
| IUPAC name | 1-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride |
| InChIKey | OXTHFDZPHYKSNY-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NO1)C2=CC=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)