CAS 1783401-69-3 appears in our catalog under these names: Quinazoline-8-carboxylic acid, 98%, 98%, QUINAZOLINE-8-CARBOXYLIC ACID, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
Quinazoline-8-carboxylic acid (CAS 1783401-69-3) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: quinazoline-8-carboxylic acid. InChIKey: UPGZAERNNNZSPM-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | quinazoline-8-carboxylic acid |
| InChIKey | UPGZAERNNNZSPM-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=CN=C2C(=C1)C(=O)O |
Computed by PubChem (NCBI)