Products 1785203-27-1
CAS 1785203-27-1 is the registry number for 7-chloro-5-fluoro-1H-indole-3-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
7-chloro-5-fluoro-1H-indole-3-carboxylic acid (CAS 1785203-27-1) is a chemical compound with the molecular formula C9H5ClFNO2 and a molecular weight of 213.59 g/mol. IUPAC name: 7-chloro-5-fluoro-1H-indole-3-carboxylic acid. InChIKey: PXZVGLNLOIVTBK-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO2 |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | 7-chloro-5-fluoro-1H-indole-3-carboxylic acid |
| InChIKey | PXZVGLNLOIVTBK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=CN2)C(=O)O)Cl)F |
Computed by PubChem (NCBI)