Products 1790-91-6
CAS 1790-91-6 appears in our catalog under these names: 2,3-Dichloro-6,7-dimethoxyquinoxaline, 95%, 95%, 2,3-Dichloro-6,7-dimethoxyquinoxaline, 95%. Offered by: Chemat, Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
2,3-dichloro-6,7-dimethoxyquinoxaline (CAS 1790-91-6) is a chemical compound with the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. IUPAC name: 2,3-dichloro-6,7-dimethoxyquinoxaline. InChIKey: NQGVKCNEXNZDPT-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2O2 |
|---|---|
| Molecular weight | 259.09 g/mol |
| IUPAC name | 2,3-dichloro-6,7-dimethoxyquinoxaline |
| InChIKey | NQGVKCNEXNZDPT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=C(C(=N2)Cl)Cl)OC |
Computed by PubChem (NCBI)