Products 179457-70-6
CAS 179457-70-6 appears in our catalog under these names: 2–Methoxyanofinic acid, 2-Methoxyanofinic acid. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 25 mg, 1 mg, 5 mg, 10 mg.
7-methoxy-2,2-dimethylchromene-6-carboxylic acid (CAS 179457-70-6) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: 7-methoxy-2,2-dimethylchromene-6-carboxylic acid. InChIKey: WVJWSWIKHOYGHH-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 7-methoxy-2,2-dimethylchromene-6-carboxylic acid |
| InChIKey | WVJWSWIKHOYGHH-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=CC(=C(C=C2O1)OC)C(=O)O)C |
Computed by PubChem (NCBI)