Products 1795188-95-2
CAS 1795188-95-2 appears in our catalog under these names: (3-Methanesulfonylpyridin-2-yl)methanamine hydrochloride, (3-(Methylsulfonyl)pyridin-2-yl)methanamine hydrochloride, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg.
(3-methylsulfonyl-2-pyridinyl)methanamine;hydrochloride (CAS 1795188-95-2) is a chemical compound with the molecular formula C7H11ClN2O2S and a molecular weight of 222.69 g/mol. IUPAC name: (3-methylsulfonyl-2-pyridinyl)methanamine;hydrochloride. InChIKey: GYWHQFRQCDSMHA-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2S |
|---|---|
| Molecular weight | 222.69 g/mol |
| IUPAC name | (3-methylsulfonyl-2-pyridinyl)methanamine;hydrochloride |
| InChIKey | GYWHQFRQCDSMHA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(N=CC=C1)CN.Cl |
Computed by PubChem (NCBI)