CAS 1798303-75-9 is the registry number for Cot-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(2-amino-5-naphthalen-2-yl-3-pyridinyl)prop-2-enoic acid (CAS 1798303-75-9) is a chemical compound with the molecular formula C18H14N2O2 and a molecular weight of 290.3 g/mol. IUPAC name: (E)-3-(2-amino-5-naphthalen-2-yl-3-pyridinyl)prop-2-enoic acid. InChIKey: VZCJIXLWKDIMAV-BQYQJAHWSA-N.
| Molecular formula | C18H14N2O2 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | (E)-3-(2-amino-5-naphthalen-2-yl-3-pyridinyl)prop-2-enoic acid |
| InChIKey | VZCJIXLWKDIMAV-BQYQJAHWSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC(=C(N=C3)N)/C=C/C(=O)O |
Computed by PubChem (NCBI)