CAS 18031-97-5 is the registry number for 6-Phenylfuro[2,3-d]pyrimidin-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-phenylfuro[2,3-d]pyrimidin-4-amine (CAS 18031-97-5) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 6-phenylfuro[2,3-d]pyrimidin-4-amine. InChIKey: KLUPXPVKDBPOMJ-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 6-phenylfuro[2,3-d]pyrimidin-4-amine |
| InChIKey | KLUPXPVKDBPOMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(N=CN=C3O2)N |
Computed by PubChem (NCBI)