Products 1803291-27-1
CAS 1803291-27-1 is the registry number for 10-Chlorobenzo[kl]xanthene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene (CAS 1803291-27-1) is a chemical compound with the molecular formula C16H9ClO and a molecular weight of 252.69 g/mol. IUPAC name: 4-chloro-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene. InChIKey: RLGMLCZFXWOQDH-UHFFFAOYSA-N.
| Molecular formula | C16H9ClO |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | 4-chloro-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
| InChIKey | RLGMLCZFXWOQDH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C4=C(C=CC(=C4)Cl)OC3=CC=C2 |
Computed by PubChem (NCBI)